| Supplier |
Creative Peptides |
| Product # |
Z10-101-165 |
| CAS # |
31282-04-9 |
| Pricing |
Inquire
|
| Synonyms |
Hygromycin b
|
| MolecularFormula |
C20H37N3O13
|
| MolecularWeight |
527.52
|
| Storage |
−20°C
|
| ShippingCondition |
Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs.
|
| Explanation |
Hygromycin B is a fda approved antibiotic food additive for swine and poultry Hygromycin B is an antibiotic produced by the bacterium Streptomyces hygroscopicus. It is an aminoglycoside that kills bacteria, fungi and higher eukaryotic cells by inhibiting protein synthesis.
|
| Application |
Hygromycin B, as an antibiotic, used for selection of cells transfected with E. coli hygromycin resistance gene.
|
| InChI |
InChI=1S/C20H37N3O13/c1-23-7-2-5(21)9(26)15(10(7)27)33-19-17-16(11(28)8(4-25)32-19)35-20(36-17)18(31)13(30)12(29)14(34-20)6(22)3-24/h5-19,23-31H,2-4,21-22H2,1H3/t5-,6-,7+,8-,9+,10-,11+,12-,13+,14-,15-,16+,17+,18-,19+,20+/m1/s1
|
| InChIKey |
GRRNUXAQVGOGFE-XKIAHZFYSA-N
|
| Solubility |
Soluble in DMSO
|
| IsomericSMILES |
CN[C@H]1C[C@H]([C@@H]([C@H]([C@@H]1O)O[C@H]2[C@@H]3[C@H]([C@H]([C@H](O2)CO)O)O[C@]4(O3)[C@@H]([C@H]([C@H]([C@H](O4)[C@@H](CO)N)O)O)O)O)N
|
| Appearance |
Solid powder
|
| BiologicalActivity |
Hygromycin B is an aminoglycoside antibiotic produced by Streptomyces hygroscopicus. It kills bacteria, fungi and higher eukaryotic cells by inhibiting protein synthesis.
|
| Purity |
>98% (or refer to the Certificate of Analysis)
|
| AreasOfInterest |
- Immunology & Inflammation
- Cell Biology
- Cancer
|
| ShortTermStorageConditions |
Dry, dark and at 0 - 4 °C
|
| LongTermStorageConditions |
-20 °C
|
| Functions |
Hygromycin B is used as an anthelmintic against swine infections by large roundworms, nodular worms, and whipworms.
|
| LabelingTarget |
30s ribosomal subunit
|
| BoilingPoint |
897.6±65.0 °C at 760 mmHg
|
| MeltingPoint |
160-180ºC
|