1-O-Acetyl-3,5-di-O-benzoyl-2-deoxy-2-fluoro-b-D-ribofuranoside
1-O-Acetyl-3,5-di-O-benzoyl-2-deoxy-2-fluoro-b-D-ribofuranoside is a powerful nucleoside analogue with potent antiviral properties used to combat infectious viruses such as influenza and hepatitis B that replicate through polymerase activity. Additionally, this incredible compound has been extensively researched for its cytotoxic potential against multidrug-resistant cancer cells, offering a new frontier for cancer treatment. With its precise targeting and potent activity, 1-O-Acetyl-3,5-di-O-benzoyl-2-deoxy-2-fluoro-b-D-ribofuranoside is a promising treatment option for a range of viral and cancerous diseases.
Supplier | BOC Sciences |
---|---|
Product # | 149623-91-6 |
Pricing | Inquire |
Cas | 149623-91-6 |
Molecular Weight | 402.37 |
Molecular Formula | C21H19FO7 |
Canonical SMILES | CC(=O)OC1C(C(C(O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)F |