1-O-Acetyl-3,5-di-O-benzoyl-2-deoxy-2-fluoro-b-D-ribofuranoside

1-O-Acetyl-3,5-di-O-benzoyl-2-deoxy-2-fluoro-b-D-ribofuranoside is a powerful nucleoside analogue with potent antiviral properties used to combat infectious viruses such as influenza and hepatitis B that replicate through polymerase activity. Additionally, this incredible compound has been extensively researched for its cytotoxic potential against multidrug-resistant cancer cells, offering a new frontier for cancer treatment. With its precise targeting and potent activity, 1-O-Acetyl-3,5-di-O-benzoyl-2-deoxy-2-fluoro-b-D-ribofuranoside is a promising treatment option for a range of viral and cancerous diseases.
Supplier BOC Sciences
Product # 149623-91-6
Pricing Inquire
Cas 149623-91-6
Molecular Weight 402.37
Molecular Formula C21H19FO7
Canonical SMILES CC(=O)OC1C(C(C(O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)F
Feedback