6-Me-5'-AMP
6-Me-5'-AMP is an adenosine monophosphate analog, exhibiting remarkable versatility in the research of diverses as cancer, inflammation and cardiovascular diseases. This groundbreaking compound intricately influences specific biochemical pathways, thereby serving as a pivotal asset in the domains of drug discovery, development and screening.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81921-35-9 |
| Pricing | Inquire |
| Cas | 81921-35-9 |
| Molecular Weight | 361.3 (free acid) |
| Molecular Formula | C11H16N5O7P (free acid) |
| Canonical SMILES | CNC1=C2C(=NC=N1)N(C=N2)C3C(C(C(O3)COP(=O)([O-])[O-])O)O.[Na+].[Na+] |