TB5
TB5 is a competitive and reversible monoamine oxidase B (MAO-B) inhibitor (Ki values 1.45 µM and 0.11 µM for hMAO-A and hMAO-B, respectively). TB5 is identified as potential treatment of neurodegenerative disorders such as Parkinson's and Alzheimer's diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 948841-07-4 |
| Pricing | Inquire |
| Cas | 948841-07-4 |
| Molecular Weight | 336.25 |
| Molecular Formula | C15H14BrNOS |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C=CC(=O)C2=CC=C(S2)Br |