4-Nitrophenyl trans-ferulate
4-Nitrophenyl trans-ferulate is a bioactive compound used in biomedical research. With its ability to inhibit tumor cell growth, it shows potential as an anticancer drug. This compound is also employed in the study of inflammatory diseases and as an antioxidant compound due to its free radical scavenging properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 398128-60-4 |
| Pricing | Inquire |
| Cas | 398128-60-4 |
| Molecular Weight | 315.28 |
| Molecular Formula | C16H13NO6 |
| Canonical SMILES | COC1=C(C=CC(=C1)C=CC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])O |