2,3,6,2,3,4,6-Hepta-O-acetyl-b-D-lactosyl isothiocyanate
2,3,6,2,3,4,6-Hepta-O-acetyl-b-D-lactosyl isothiocyanate, a highly sought-after compound within the biomedical sector, plays a pivotal role in the progressive advancement of targeted drug delivery systems. This exceptional substance, possessing unique attributes, facilitates the conjugation of therapeutic medications, thereby enhancing their efficacy when directed towards cancer cells, bacterial infections, or other specific locations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 77489-36-2 |
| Pricing | Inquire |
| Cas | 77489-36-2 |
| Molecular Weight | 677.64 |
| Molecular Formula | C27H35NO17S |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)N=C=S)OC(=O)C)OC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |