4-Acetamidophenylboronic Acid
Reactant involved in: Synthesis of TpI2 kinase inhibitors; Biological evaluation of modulators of survival motor neuron protein; Cross-coupling with conjugated dienes or terminal alkenes or diazoesters; Synthesis of tetrabutylammonium trifluoroborates; Rhosium-catalyzed cyanation.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB000474 |
| Pricing | Inquire |
| Cas | 101251-09-6 |
| Molecular Weight | 178.98 |
| Molecular Formula | C8H10NO3B |
| Canonical SMILES | B(C1=CC=C(C=C1)NC(=O)C)(O)O |