Anserinone B
Anserinone B has antifungal, antibacterial and cytotoxic properties. It causes radial growth reductions of 50% and 37% against S. fimicola and A. furfuraceus, respectively. It also shows moderate cytotoxicity in the NCI's 60 human tumor cell line panel (GI50 = 4.4 µg/mL).
| Supplier | BOC Sciences |
|---|---|
| Product # | 190895-96-6 |
| Pricing | Inquire |
| Cas | 190895-96-6 |
| Molecular Weight | 210.23 |
| Molecular Formula | C11H14O4 |
| Canonical SMILES | CC1=C(C(=O)C(=CC1=O)OC)CC(C)O |