5'-O-(4,4'-Dimethoxytrityl)-3'-O-(2-methoxyethyl)-5-methyluridine
5'-O-(4,4'-Dimethoxytrityl)-3'-O-(2-methoxyethyl)-5-methyluridine is a nucleoside derivative, acting as a vital building block in synthesizing nucleic acids. With its unique structural modifications, this compound finding applications in the development of nucleic acid-based drugs, especially those aimed at targeting viral infections, genetic disorders is and various types of cancers.
| Supplier | BOC Sciences |
|---|---|
| Product # | 256223-94-6 |
| Pricing | Inquire |
| Cas | 256223-94-6 |
| Molecular Weight | 618.67 |
| Molecular Formula | C34H38N2O9 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OCCOC)O |