5'-O-p-Anisoyl-N4-benzoyl-2',3'-dideoxycytidine
5'-O-p-Anisoyl-N4-benzoyl-2',3'-dideoxycytidine, a highly potent antiviral compound widely utilized in the biomedical field, is primarily indicated for the management of viral ailments, particularly those caused by retroviruses. By functioning as a nucleoside analogue and interfering with viral DNA synthesis, this medication exemplifies its inhibitory prowess against retroviruses such as HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1241674-34-9 |
| Pricing | Inquire |
| Cas | 1241674-34-9 |
| Molecular Weight | 449.46 |
| Molecular Formula | C24H23N3O6 |
| Canonical SMILES | COC1=CC=C(C=C1)C(=O)OCC2CCC(O2)N3C=CC(=NC3=O)NC(=O)C4=CC=CC=C4 |