2-Nitrophenyl b-D-xylobioside
2-Nitrophenyl b-D-xylobioside, a prominent chemical compound utilized in the biomedical sector, plays a pivotal role in the investigation and analysis of enzymatic activity concerning xylanases and their counterparts. Functioning as a fundamental substrate, this compound facilitates comprehensive comprehension of the intricate mechanisms underlying xylan decomposition, an integral process within plant cell wall constitution.
| Supplier | BOC Sciences |
|---|---|
| Product # | 157956-98-4 |
| Pricing | Inquire |
| Cas | 157956-98-4 |
| Molecular Weight | 403.34 |
| Molecular Formula | C16H21NO11 |
| Canonical SMILES | C1C(C(C(C(O1)OC2COC(C(C2O)O)OC3=CC=CC=C3[N+](=O)[O-])O)O)O |