Hexyl b-D-maltopyranoside
Hexyl b-D-maltopyranoside, a pivotal compound within the realm of biomedicine, is extensively employed in the domains of drug formulation and experimental investigations. It demonstrates extraordinary potential in augmenting the solubility and durability of myriad pharmaceutical agents. Furthermore, its application extends to the therapeutic interventions of specific maladies, including cancer and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870287-95-9 |
| Pricing | Inquire |
| Cas | 870287-95-9 |
| Molecular Weight | 426.46 |
| Molecular Formula | C18H34O11 |
| Canonical SMILES | CCCCCCOC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O |