2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl cyanide
2,3,5-Tri-O-benzoyl-b-D-ribofuranosyl cyanide is a quintessential cornerstone in the fabrication of antiviral nucleosides, playing a role in combating pernicious maladies such as HIV and hepatitis B through the application in potent pharmaceutical concoctions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 23316-67-8 |
| Pricing | Inquire |
| Cas | 23316-67-8 |
| Molecular Weight | 471.46 |
| Molecular Formula | C27H21NO7 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)C#N)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |