3-Iodo-6-(1-methylethyl)-1H-indole-2-carboxylic Acid
3-Iodo-6-(1-methylethyl)-1H-indole-2-carboxylic Acid is an analog of 3-Chloro-6-(1-methylethyl)-1H-indole-2-carboxylic Acid (C369785) which is compound having an indole nucleus, that can be used for the synthesis of more complex pharmaceutical and biologically active compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB060708 |
| Pricing | Inquire |
| Cas | 1263213-93-9 |
| Molecular Weight | 329.13 |
| Molecular Formula | C12H12INO2 |
| Canonical SMILES | CC(C)C1=CC2=C(C=C1)C(=C(N2)C(=O)O)I |