Ezetimibe Impurity 9
An impurity of Ezetimibe. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L43) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-089119 |
| Pricing | Inquire |
| Cas | 272778-12-8 |
| Molecular Weight | 716.98 |
| Molecular Formula | C39H46F2N2O5Si2 |
| Canonical SMILES | C[Si](C)(C)OC1=CC=C(C=C1)C(C(CCC(C2=CC=C(C=C2)F)O[Si](C)(C)C)C(=O)N3C(COC3=O)C4=CC=CC=C4)NC5=CC=C(C=C5)F |