Fexofenadine EP Impurity C
Fexofenadine EP Impurity C is an impurity of Fexofenadine, which is a histamine H1 receptor antagonist used for the treatment of allergy symptoms, such as hay fever, nasal congestion, and urticaria.
| Supplier | BOC Sciences |
|---|---|
| Product # | 185066-37-9 |
| Pricing | Inquire |
| Cas | 185066-37-9 |
| Molecular Weight | 457.66 |
| Molecular Formula | C31H39NO2 |
| Canonical SMILES | CC(C)C1=CC=C(C=C1)C(CCCN2CCC(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O |