2-Fluoro-9-(2'-deoxy-2'-fluoro-b-D-arabinofuranosyl)adenine
2-Fluoro-9-(2'-deoxy-2'-fluoro-b-D-arabinofuranosyl)adenine is a highly effective antiviral compound extensively applied in the field of compound, demonstrates significant potency against a myriad of DNA viruses such as herpes simplex virus and varicella-zoster virus. By impeding viral DNA replication, this compound effectively thwarts viral proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 134217-15-5 |
| Pricing | Inquire |
| Cas | 134217-15-5 |
| Molecular Weight | 287.22 |
| Molecular Formula | C10H11F2N5O3 |
| Canonical SMILES | C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)F)F)N |