5-b-D-Ribofuranosyl-2(1H)-pyridinone
5-b-D-Ribofuranosyl-2(1H)-pyridinone, commonly known as Ribovirin, is a remarkable antiviral medication extensively employed for combating a diverse range of viral infections. This potent compound has demonstrated exceptional efficacy in inhibiting the replication of notorious viruses such as HIV, HCV, and HBV. By selectively impeding viral polymerases, Ribovirin obstructs viral RNA/DNA synthesis and effectively diminishes viral load.
| Supplier | BOC Sciences |
|---|---|
| Product # | 188871-50-3 |
| Pricing | Inquire |
| Cas | 188871-50-3 |
| Molecular Weight | 227.21 |
| Molecular Formula | C10H13NO5 |
| Canonical SMILES | C1=CC(=O)NC=C1C2C(C(C(O2)CO)O)O |