5'-O-DMT-N2-DMF-guanosine
5'-O-DMT-N2-DMF-guanosine, a remarkably powerful nucleoside analog, assumes a crucial role in the realm of biomedicine in combatting select malignancies. Its extraordinary molecular architecture endows it with the ability to impede the proliferation of neoplastic cells via targeted interference with distinct signaling cascades. By virtue of this distinct attribute, this compound holds potential for augmented therapeutic efficacy and mitigated untoward ramifications when used concomitantly with other chemotherapeutic agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | 126922-60-9 |
| Pricing | Inquire |
| Cas | 126922-60-9 |
| Molecular Weight | 640.69 |
| Molecular Formula | C34H36N6O7 |
| Canonical SMILES | CN(C)C=NC1=NC(=O)C2C(=N1)N(C=N2)C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O)O |