Tolypomycin Y
Tolypomycin Y is produced by the strain of Str. tolypophorus B2847. It has a broad-spectrum antimicrobial effect, which protects mice infected with gram-positive bacteria, and also has an inhibitory effect on vaccine virus.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02698 |
| Pricing | Inquire |
| Cas | 23412-26-2 |
| Molecular Weight | 822.89 |
| Molecular Formula | C43H54N2O14 |
| Canonical SMILES | CC1C(C=COC2(C(=O)C3=C(O2)C(=C(C4=C3C(=NC5CCC(OC5C)O)C=C(C4=O)NC(=O)C(=CC(=O)C6CC6C(C(C(C(C1OC(=O)C)C)O)C)O)C)O)C)C)OC |