Ezetimibe Diacid Impurity
An impurity of Ezetimibe. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L1) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1013025-04-1 |
| Pricing | Inquire |
| Cas | 1013025-04-1 |
| Molecular Weight | 437.47 |
| Molecular Formula | C25H24FNO5 |
| Canonical SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(C(CCC(=O)O)C(=O)O)NC3=CC=C(C=C3)F |