3',5'-Bis-O-benzoyl-2'-deoxy-2'-fluoro-b-D-arabino-6-azauridine
3',5'-Bis-O-benzoyl-2'-deoxy-2'-fluoro-b-D-arabino-6-azauridine is a formidable therapeutic compound, exhibiting potent antiviral activity against a spectrum of RNA viruses. Renowned for its unrivaled efficacy, this compound acting by selectively obstructing the viral RNA polymerase, thereby impeding viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1013470-68-2 |
| Pricing | Inquire |
| Cas | 1013470-68-2 |
| Molecular Weight | 455.39 |
| Molecular Formula | C22H18FN3O7 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C(=O)NC(=O)C=N3)F)OC(=O)C4=CC=CC=C4 |