4',5'-Didehydro-5'-deoxy-5-methyluridine
4',5'-Didehydro-5'-deoxy-5-methyluridine is an exquisitely compelling antiviral compound extensively employed in the thriving biomedical industry, exerting its profound efficacy in the research of pernicious viral diseases. By pertinaciously impeding viral replication, this remarkable entity exclusively targets viral RNA polymerase, holding immense potential for triumphantly research of an array of alarming viral infections plaguing humanity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1446748-33-9 |
| Pricing | Inquire |
| Cas | 1446748-33-9 |
| Molecular Weight | 240.22 |
| Molecular Formula | C10H12N2O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(=C)O2)O)O |