3-TRIFLUOROMETHYL-4-METHOXY-PHENYLBORONIC ACID
3-TRIFLUOROMETHYL-4-METHOXY-PHENYLBORONIC ACID is an indispensable compound in the field of biomedicine. It frequently assumes the status of a pivotal cornerstone in the construction of medicinal compounds aimed at combatting afflictions such as cancer, diabetes, inflammation, and neurodegenerative maladies. The distinctive chemical characteristics exhibited by this compound bestow upon it an irreplaceable role in the intricate endeavors encompassing drug exploration and formulation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 149507-36-8 |
| Pricing | Inquire |
| Cas | 149507-36-8 |
| Molecular Weight | 219.95 |
| Molecular Formula | C8H8O3BF3 |
| Canonical SMILES | B(C1=CC(=C(C=C1)OC)C(F)(F)F)(O)O |