N6-Benzoyl-7'-OH-morpholino adenosine
N6-Benzoyl-7'-OH-morpholino adenosine: A groundbreaking compound of immense significance within the biomedical domain, this innovative product exerts its inhibitory prowess with remarkable potency. Employed as a therapeutic tool, it has demonstrated unparalleled efficacy in combating a multitude of afflictions. Specifically, it functions as an adversary to certain adenosine receptors, thereby exhibiting particular promise in the realm of cardiovascular maladies encompassing myocardial infarction and arrhythmias.
| Supplier | BOC Sciences |
|---|---|
| Product # | 139290-78-1 |
| Pricing | Inquire |
| Cas | 139290-78-1 |
| Molecular Weight | 354.36 |
| Molecular Formula | C17H18N6O3 |
| Canonical SMILES | C1C(OC(CN1)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)CO |