6-O-Benzyl-2,3:4,5-di-O-cyclohexylidene-D-myo-inositol
6-O-Benzyl-2,3:4,5-di-O-cyclohexylidene-D-myo-inositol is a key compound used in the biomedical industry. It exhibits potent antiviral activity against a wide range of viruses, including HIV and influenza. Additionally, it shows promising potential in the treatment of diabetes and cancer due to its antiproliferative properties. Its diverse applications make it a valuable tool for drug development and research in the field of biomedicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 124601-98-5 |
| Pricing | Inquire |
| Cas | 124601-98-5 |
| Molecular Weight | 430.53 |
| Molecular Formula | C25H34O6 |
| Canonical SMILES | C1CCC2(CC1)OC3C(C(C4C(C3O2)OC5(O4)CCCCC5)OCC6=CC=CC=C6)O |