2-Boc-6-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline
2-Boc-6-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline (CAS# 622867-52-1) is an intermediate used to prepare phosphonate-substituted HIV protease inhibitors for treatment of AIDS and other viral infections. It is also used in the synthesis of immunosuppressant heterocyclic compdounds for treating or preventing diseases assocd. with EDG receptor mediated signal transduction.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB031506 |
| Pricing | Inquire |
| Cas | 622867-52-1 |
| Molecular Weight | 263.33 |
| Molecular Formula | C15H21NO3 |
| Canonical SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=C2)CO |