Ticagrelor impurity G
An impurity of Ticagrelor which is a reversible P2Y12 receptor antagonist and is unique in its greater and more rapid and consistent, yet reversible, inhibition of the ADP receptor.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0027-484068 |
| Pricing | Inquire |
| Cas | 220347-05-7 |
| Molecular Weight | 478.51 |
| Molecular Formula | C21H24F2N6O3S |
| Canonical SMILES | CCCSC1=NC(=C2C(=N1)N(N=N2)C3CC(C(C3O)O)O)NC4CC4C5=CC(=C(C=C5)F)F |