N4-(Diisobutylaminomethylidene)-5'-O-(dimethoxytrityl)-5-(1-propynyl)-2'-O-methylcytidine
N4-(Diisobutylaminomethylidene)-5'-O-(dimethoxytrityl)-5-(1-propynyl)-2'-O-methylcytidine- a powerful antiviral agent crucial in treating RNA viral infections, including COVID-19 and Hepatitis C. This hero compound impedes viral RNA generation while hindering the virus's spread. Its potential in the creation of novel antiviral drugs highlights its undeniable antiviral capabilities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 869355-38-4 |
| Pricing | Inquire |
| Cas | 869355-38-4 |
| Molecular Weight | 736.91 |
| Molecular Formula | C43H52N4O7 |
| Canonical SMILES | CC#CC1=CN(C(=O)N=C1N=CN(CC(C)C)CC(C)C)C2C(C(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O)OC |