UDP-N-acetyl-D-mannosamine
UDP-N-acetyl-D-mannosamine is a key compound in the biomedical sector, exhibiting indispensability in synthesizing sialic acids, which carry out pivotal functions across diverse biological phenomena. with application in glycoprotein, glycolipid and essential molecule production, it assumes a critical role in cellular communication, immune response modulation and neurobiological processes. Furthermore, its utilization extends to disease research and investigative endeavors regarding cancer, viral infections and genetic anomalies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 26575-17-7 |
| Pricing | Inquire |
| Cas | 26575-17-7 |
| Molecular Weight | 607.35 |
| Molecular Formula | C17H27N3O17P2 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)CO)O)O |