2-(Boc-amino)pyridine
2-(Boc-amino)pyridine (CAS# 38427-94-0) is a protected derivative of the amino acid Pyridine, a heterocyclic compound that is commonly found in biological specimens (such as human red blood cells), and is used as a starting reagent and intermediate in the chemical and pharmaceutical industries.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38427-94-0 |
| Pricing | Inquire |
| Cas | 38427-94-0 |
| Molecular Weight | 194.23 |
| Molecular Formula | C10H14N2O2 |
| Canonical SMILES | CC(C)(C)OC(=O)NC1=CC=CC=N1 |