Rivaroxaban EP Impurity B
An impurity of Rivaroxaban. Rivaroxaban inhibits both free Factor Xa and Factor Xa bound in the prothrombinase complex. Rivaroxaban is used to treat deep vein thrombosis and pulmonary embolism in adults.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1429334-00-8 |
| Pricing | Inquire |
| Cas | 1429334-00-8 |
| Molecular Weight | 333.35 |
| Molecular Formula | C16H19N3O5 |
| Canonical SMILES | CC(=O)NCC1CN(C(=O)O1)C2=CC=C(C=C2)N3CCOCC3=O |