2'-Chloro-2'-deoxyuridine 5'-triphosphate
2'-Chloro-2'-deoxyuridine 5'-triphosphate is an imperative entity in the realm of biomedicine, often employed as a substrate for DNA polymerases across diverse molecular biology contexts. This compound facilitates the synthesis of altered DNA, thereby enabling meticulous investigations into DNA replication, mutagenesis, and gene expression. Furthermore, its integration into DNA serves as a valuable instrument for scrutinizing drug resistance and mechanisms pertaining to DNA repair.
| Supplier | BOC Sciences |
|---|---|
| Product # | 61468-91-5 |
| Pricing | Inquire |
| Cas | 61468-91-5 |
| Molecular Weight | 502.59 |
| Molecular Formula | C9H14ClN2O14P3 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)Cl |