2'-Deoxyadenosine-5'-carboxylic acid
2'-Deoxyadenosine-5'-carboxylic acid is an indispensable biochemical compound extensively employed in the biomedical sector possessing profound implications in the synthesis of nucleotides and nucleic acids. It emanates as an invaluable compound in studying genetic disorders, viral infections and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4603-70-7 |
| Pricing | Inquire |
| Cas | 4603-70-7 |
| Molecular Weight | 265.23 |
| Molecular Formula | C10H11N5O4 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)C(C(=O)O)O)O |