Semilicoisoflavone B
Semilicoisoflavone B is a compound of the flavonoid class found in the roots of Glycyrrhiza uralensis Fisch. Study shows that Semilicoisoflavone B inhibits sorbitol formation of rat lens incubated with a high concentration of glucose.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0005-053342 |
| Pricing | 5 mg/unit USD $839 |
| Cas | 129280-33-7 |
| Molecular Weight | 352.342 |
| Molecular Formula | C20H16O6 |
| Canonical SMILES | CC1(C=CC2=C(O1)C(=CC(=C2)C3=COC4=CC(=CC(=C4C3=O)O)O)O)C |