2,6-Difluoroanilino(oxo)acetic acid
2,6-Difluoroanilino(oxo)acetic acid is a key intermediate in the synthesis of various biomedically important compounds. It primarily aids in the production of pharmaceuticals aimed at treating neurodegenerative diseases and certain types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1018295-42-5 |
| Pricing | Inquire |
| Cas | 1018295-42-5 |
| Molecular Weight | 201.13 |
| Molecular Formula | C8H5F2NO3 |
| Canonical SMILES | C1=CC(=C(C(=C1)F)NC(=O)C(=O)O)F |