Alphadolone 21-b-D-glucuronide
Alphadolone 21-b-D-glucuronide is an innovative compound, used in research of the relentless scope of neurodegenerative diseases. By selectively engaging receptors pivotal in disease development, this formidable neuroprotective compound adeptly thwarts pathological mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 36707-55-8 |
| Pricing | Inquire |
| Cas | 36707-55-8 |
| Molecular Weight | 524.60 |
| Molecular Formula | C27H40O10 |
| Canonical SMILES | CC12CCC(CC1CCC3C2C(=O)CC4(C3CCC4C(=O)COC5C(C(C(C(O5)C(=O)O)O)O)O)C)O |