2'-C-Methylisoguanosine
2'-C-Methylisoguanosine, a modified nucleoside, has demonstrated significant antiviral efficacy against hepatitic C and West Nile virus, as well as promising potential in treating cancer, based on existing studies. This compound's effectiveness and distinct chemical structure highlight its potential value as a multifaceted therapeutic agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | 714249-83-9 |
| Pricing | Inquire |
| Cas | 714249-83-9 |
| Molecular Weight | 297.27 |
| Molecular Formula | C11H15N5O5 |
| Canonical SMILES | CC1(C(C(OC1N2C=NC3=C(NC(=O)N=C32)N)CO)O)O |