1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-b-D-galactopyranose
1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-b-D-galactopyranose, commonly known as Ac4GalNAz, is a highly versatile and multifaceted chemical compound used as a building block in the synthesis of azido sugar derivatives. This complex structure exhibits an unparallel degree of perplexity, and has found widespread applications in the field of glycoconjugate-based immunotherapies and drug discovery. Furthermore, Ac4GalNAz is considered as a critical biochemical tool for investigating the mechanisms of carbohydrate-mediated biological processes, thus underscoring its immense potential in the domain of glycomics research. In light of its wide-ranging applications, Ac4GalNAz is widely regarded as a ground-breaking discovery in the field of carbohydrate chemistry.
| Supplier | BOC Sciences |
|---|---|
| Product # | 68733-19-7 |
| Pricing | Inquire |
| Cas | 68733-19-7 |
| Molecular Weight | 373.32 |
| Molecular Formula | C14H19N3O9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)N=[N+]=[N-])OC(=O)C)OC(=O)C |