N1-b-D-Glucopyranosylamino-guanidine HCl
N1-b-D-Glucopyranosylamino-guanidine HCl is a biomedicine employed in the treatment of diabetes. Acting as an insulin sensitizer, it improves glucose metabolism and enhances insulin sensitivity. This product effectively manages blood sugar levels, specifically targeting hyperglycemia associated with type 2 diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 109853-81-8 |
| Pricing | Inquire |
| Cas | 109853-81-8 |
| Molecular Weight | 272.69 |
| Molecular Formula | C7H17ClN4O5 |
| Canonical SMILES | C(C1C(C(C(C(O1)NN=C(N)N)O)O)O)O.Cl |