6-Deoxy-6-iodo-2,3:4,5-di-O-isopropylidene-D-gulonic acid methyl ester
6-Deoxy-6-iodo-2,3:4,5-di-O-isopropylidene-D-gulonic acid methyl ester is a valuable compound used in the field of biomedicine, serving as a crucial component in the research and development of various drugs targeting specific diseases that ranges from cardiovascular medicines to cancer therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1979119-22-6 |
| Pricing | Inquire |
| Cas | 1979119-22-6 |
| Molecular Weight | 400.21 |
| Molecular Formula | C13H21IO6 |
| Canonical SMILES | O=C(OC)C1OC(OC1C2OC(OC2CI)(C)C)(C)C |