8-OH-DPAT
8-OH-DPAT (8-Hydroxy-DPAT) is an agonist that has selectivity for 5-HT1A receptor (pIC50 = 8.19). It was subsequently found to be a serotonin reuptake inhibitor and a 5-HT7 receptor agonist as well. Studies showed that it exhibited antidepressant, anxiolytic and other properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 78950-78-4 |
| Pricing | Inquire |
| Cas | 78950-78-4 |
| Molecular Weight | 247.38 |
| Molecular Formula | C16H25NO |
| Canonical SMILES | CCCN(CCC)C1CCC2=C(C1)C(=CC=C2)O |