1-Naphthyl a-D-galactopyranoside
1-Naphthyl a-D-galactopyranoside is a galactoside used as a substrate in the study of galactosidase enzymes, helping in the research monitoring of medication efficacy targeting lysosomal storage diseases like Fabry's disease or Gaucher's disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 65174-63-2 |
| Pricing | Inquire |
| Cas | 65174-63-2 |
| Molecular Weight | 306.31 |
| Molecular Formula | C16H18O6 |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2OC3C(C(C(C(O3)CO)O)O)O |