3',5'-O-(1,1,3,3-Tetraisopropyl-1,3-disiloxanediyl)cytidine
3',5'-O-(1,1,3,3-Tetraisopropyl-1,3-disiloxanediyl)cytidine, a nucleoside analogue drug, acts as an inhibitor of viral replication to alleviate hepatitis B and C. With its action aimed at blocking reverse transcriptase, the virus loses its ability to propagate. Besides being effective against these chronic infections, the drug has exhibited encouraging results in combatting cancerous cells and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 69304-42-3 |
| Pricing | Inquire |
| Cas | 69304-42-3 |
| Molecular Weight | 485.72 |
| Molecular Formula | C21H39N3O6Si2 |
| Canonical SMILES | CC(C)[Si]1(OCC2C(C(C(O2)N3C=CC(=NC3=O)N)O)O[Si](O1)(C(C)C)C(C)C)C(C)C |