2-Bromo-3-ethoxy-6-fluorophenylboronic acid
2-Bromo-3-ethoxy-6-fluorophenylboronic Acid is a specific reagent used in medicinal chemistry and drug development. It has high utility in Suzuki-Miyaura cross-coupling reactions, contributing to the synthesis of bioactive compounds targeted towards disease treatment, including various cancers.
| Supplier | BOC Sciences |
|---|---|
| Product # | 849052-19-3 |
| Pricing | Inquire |
| Cas | 849052-19-3 |
| Molecular Weight | 262.87 |
| Molecular Formula | C8H9BBrFO3 |
| Canonical SMILES | B(C1=C(C=CC(=C1Br)OCC)F)(O)O |