4-Chloro-3-(trifluoromethyl)phenyl isocyanate
4-Chloro-3-(trifluoromethyl)phenyl isocyanate (CAS# 327-78-6) is used as a reagent to synthesize pyrimidinylaminobenzene derivatives, compounds that have antiproliferative activity against melanoma cell lines. 4-Chloro-3-(trifluoromethyl)phenyl isocyanate is also used to synthesize α-thymidine analogues that act as antimalarial agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | 327-78-6 |
| Pricing | Inquire |
| Cas | 327-78-6 |
| Molecular Weight | 221.56 |
| Molecular Formula | C8H3ClF3NO |
| Canonical SMILES | C1=CC(=C(C=C1N=C=O)C(F)(F)F)Cl |