2-Aminopurine-9-beta-D-(2'-deoxy-2'-fluoro)arabino-riboside

2-Aminopurine-9-beta-D-(2'-deoxy-2'-fluoro)arabino-riboside, a nucleoside analog with potential antiviral activity against diseases such as HIV and hepatitis B, functions by disrupting the viral replication process via inhibition of the reverse transcriptase enzyme. Its widespread use as a research tool in virology highlights its importance in further discoveries and potential therapeutic applications.
Supplier BOC Sciences
Product # 109304-04-3
Pricing Inquire
Cas 109304-04-3
Molecular Weight 269.23
Molecular Formula C10H12FN5O3
Canonical SMILES C1=C2C(=NC(=N1)N)N(C=N2)C3C(C(C(O3)CO)O)F
Feedback