Cefradine Impurity 1
4',5'-Dihydrocephradine is an impurity in the synthesis of Cephradine, a first generation cephalosporin antibiotic. Cephradine has broad spectrum of bactericidal activity against infections caused by Streptococcus, Staphylococcus, Diplococcus pneumoniae, Escherichia, Klebsiella, Salmonella, and indole-negative Proteus.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37051-00-6 |
| Pricing | Inquire |
| Cas | 37051-00-6 |
| Molecular Weight | 351.43 |
| Molecular Formula | C16H21N3O4S |
| Canonical SMILES | CC1=C(N2C(C(C2=O)NC(=O)C(C3=CCCCC3)N)SC1)C(=O)O |