15(S)-HETE ethanolamide
Arachidonoyl ethanolamide (AEA) was the first endogenous cannabinoid (CB) to be isolated and characterized as an agonist acting on the same receptors (CB1 and CB2) as THC. 15(S)-HETE ethanolamide is less potent than AEA at the CB1 receptor (Ki of 600 versus 90 nM). 15(S)-HETE ethanolamide also inhibits fatty acid amide hydrolase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 161744-53-2 |
| Pricing | Inquire |
| Cas | 161744-53-2 |
| Molecular Weight | 363.5 |
| Molecular Formula | C22H37NO3 |
| Canonical SMILES | CCCCCC(C=CC=CCC=CCC=CCCCC(=O)NCCO)O |