Medroxyprogesterone Acetate EP Impurity G
Medroxyprogesterone Acetate EP Impurity G is a synthetic progesteronal agent with an IC50 of 260 μM for the inhibition of HepG2. Medroxyprogesterone Acetate EP Impurity G is a manufactured hormone of the progestin type.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP3297 |
| Pricing | Inquire |
| Cas | 595-33-5 |
| Molecular Weight | 384.51 |
| Molecular Formula | C24H32O4 |
| Canonical SMILES | CC1=CC2C(CCC3(C2CCC3(C(=O)C)OC(=O)C)C)C4(C1=CC(=O)CC4)C |